EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H22N4O |
| Net Charge | 0 |
| Average Mass | 310.401 |
| Monoisotopic Mass | 310.17936 |
| SMILES | C#CCN(C(=O)c1cnn([C@H](C)C(C)C)c1C)c1cccnc1 |
| InChI | InChI=1S/C18H22N4O/c1-6-10-21(16-8-7-9-19-11-16)18(23)17-12-20-22(15(17)5)14(4)13(2)3/h1,7-9,11-14H,10H2,2-5H3/t14-/m1/s1 |
| InChIKey | XVEMIMCGUGJHOV-CQSZACIVSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-dimpyrargyl (CHEBI:747165) is a 5-methyl-1-(3-methylbutan-2-yl)-N-(prop-2-yn-1-yl)-N-(pyridin-3-yl)-1H-pyrazole-4-carboxamide (CHEBI:747164) |
| (R)-dimpyrargyl (CHEBI:747165) is enantiomer of (S)-dimpyrargyl (CHEBI:747166) |
| Incoming Relation(s) |
| dimpyrargyl (CHEBI:747168) has part (R)-dimpyrargyl (CHEBI:747165) |
| (S)-dimpyrargyl (CHEBI:747166) is enantiomer of (R)-dimpyrargyl (CHEBI:747165) |
| IUPAC Name |
|---|
| 5-methyl-1-[(2R)-3-methylbutan-2-yl]-N-(prop-2-yn-1-yl)-N-(pyridin-3-yl)-1H-pyrazole-4-carboxamide |