EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H33O3 |
| Net Charge | -1 |
| Average Mass | 321.481 |
| Monoisotopic Mass | 321.24352 |
| SMILES | CCCCC/C=C\C/C=C\C=C\[C@@H](O)CCCCCCC(=O)[O-] |
| InChI | InChI=1S/C20H34O3/c1-2-3-4-5-6-7-8-9-10-13-16-19(21)17-14-11-12-15-18-20(22)23/h6-7,9-10,13,16,19,21H,2-5,8,11-12,14-15,17-18H2,1H3,(H,22,23)/p-1/b7-6-,10-9-,16-13+/t19-/m1/s1 |
| InChIKey | SKIQVURLERJJCK-RDCCVJQZSA-M |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 8(S)-HETrE(1-) (CHEBI:747161) is a HETrE (CHEBI:72793) |
| 8(S)-HETrE(1-) (CHEBI:747161) is conjugate base of 8(S)-HETrE (CHEBI:140473) |
| Synonym | Source |
|---|---|
| FA 20:3(9E,11Z,14Z;8OH) | SUBMITTER |
| UniProt Name | Source |
|---|---|
| (8S)-hydroxy-(9E,11Z,14Z)-icosatrienoate | UniProt |