EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H33O5 |
| Net Charge | -1 |
| Average Mass | 353.479 |
| Monoisotopic Mass | 353.23335 |
| SMILES | CCCCC[C@@H](O)/C=C/[C@@H]1[C@H](C/C=C\CCCC(=O)[O-])[C@@H](O)C[C@H]1O |
| InChI | InChI=1S/C20H34O5/c1-2-3-6-9-15(21)12-13-17-16(18(22)14-19(17)23)10-7-4-5-8-11-20(24)25/h4,7,12-13,15-19,21-23H,2-3,5-6,8-11,14H2,1H3,(H,24,25)/p-1/b7-4-,13-12+/t15-,16+,17-,18+,19-/m1/s1 |
| InChIKey | PXGPLTODNUVGFL-PGWUFSIFSA-M |
| Roles Classification |
|---|
| Application: | biomarker A substance used as an indicator of a biological state. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 15-epi-15-F2t-IsoP(1-) (CHEBI:747155) is a F2-isoprostane (CHEBI:142058) |
| 15-epi-15-F2t-IsoP(1-) (CHEBI:747155) is conjugate base of 15-epi-15-F2t-IsoP (CHEBI:165290) |
| Synonym | Source |
|---|---|
| (9S,11R,15R)-15-F2-IsoP[8S,12R](1-) | SUBMITTER |
| UniProt Name | Source |
|---|---|
| 9S,11R,15R-trihydroxy-5Z,13E-prostadienoate-cyclo[8S,12R] | UniProt |