EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H17N3O4 |
| Net Charge | 0 |
| Average Mass | 279.296 |
| Monoisotopic Mass | 279.12191 |
| SMILES | N[C@@H](Cc1ccccc1)C(=O)NCC(=O)NCC(=O)O |
| InChI | InChI=1S/C13H17N3O4/c14-10(6-9-4-2-1-3-5-9)13(20)16-7-11(17)15-8-12(18)19/h1-5,10H,6-8,14H2,(H,15,17)(H,16,20)(H,18,19)/t10-/m0/s1 |
| InChIKey | NAXPHWZXEXNDIW-JTQLQIEISA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Phe-Gly-Gly (CHEBI:74714) has role metabolite (CHEBI:25212) |
| Phe-Gly-Gly (CHEBI:74714) is a tripeptide (CHEBI:47923) |
| IUPAC Name |
|---|
| L-phenylalanylglycylglycine |
| Synonyms | Source |
|---|---|
| FGG | ChEBI |
| N-(N-L-phenylalanylglycyl)-glycine | ChemIDplus |
| phenylalanylglycylglycine | ChEBI |
| L-Phe-Gly-Gly | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2167248 | Reaxys |
| CAS:23576-42-3 | ChemIDplus |