EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C39H67N5O7 |
| Net Charge | 0 |
| Average Mass | 717.993 |
| Monoisotopic Mass | 717.50405 |
| SMILES | [H][C@@]1([C@H](OC)[C@@H](C)C(=O)N[C@H](C)[C@@H](O)c2ccccc2)CCCN1C(=O)C[C@@H](OC)C([C@@H](C)CC)N(C)C(=O)[C@@H](NC(=O)[C@@H](NC)C(C)C)C(C)C |
| InChI | InChI=1S/C39H67N5O7/c1-13-25(6)34(43(10)39(49)33(24(4)5)42-38(48)32(40-9)23(2)3)30(50-11)22-31(45)44-21-17-20-29(44)36(51-12)26(7)37(47)41-27(8)35(46)28-18-15-14-16-19-28/h14-16,18-19,23-27,29-30,32-36,40,46H,13,17,20-22H2,1-12H3,(H,41,47)(H,42,48)/t25-,26+,27+,29-,30+,32-,33-,34?,35+,36+/m0/s1 |
| InChIKey | DASWEROEPLKSEI-AWNAIHLBSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Monomethyl auristatin E (vedotin) (CHEBI:747132) has role antineoplastic agent (CHEBI:35610) |
| Monomethyl auristatin E (vedotin) (CHEBI:747132) is a secondary carboxamide (CHEBI:140325) |
| Monomethyl auristatin E (vedotin) (CHEBI:747132) is a tertiary carboxamide (CHEBI:140326) |
| Synonyms | Source |
|---|---|
| MMAE | CAS |
| Monomethylauristatin E | CAS |
| Manual Xrefs | Databases |
|---|---|
| D09691 | KEGG DRUG |
| DBMET02167 | DrugBank Metabolite |
| Monomethyl_auristatin_E | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:474645-27-7 | CAS |