EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H28N6O3 |
| Net Charge | 0 |
| Average Mass | 448.527 |
| Monoisotopic Mass | 448.22229 |
| SMILES | O=c1ccc2ncc(=O)n3c2n1C[C@H]3CN1CCC(NCc2cc3c(cn2)OCCC3)CC1 |
| InChI | InChI=1S/C24H28N6O3/c31-22-4-3-20-24-29(22)15-19(30(24)23(32)13-27-20)14-28-7-5-17(6-8-28)25-11-18-10-16-2-1-9-33-21(16)12-26-18/h3-4,10,12-13,17,19,25H,1-2,5-9,11,14-15H2/t19-/m1/s1 |
| InChIKey | PZFAZQUREQIODZ-LJQANCHMSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| Application: | antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gepotidacin (CHEBI:747127) has role antibacterial agent (CHEBI:33282) |
| gepotidacin (CHEBI:747127) has role antiinfective agent (CHEBI:35441) |
| gepotidacin (CHEBI:747127) is a aminopiperidine (CHEBI:48588) |
| gepotidacin (CHEBI:747127) is a organic heterotricyclic compound (CHEBI:26979) |
| gepotidacin (CHEBI:747127) is a pyranopyridine (CHEBI:38192) |
| gepotidacin (CHEBI:747127) is a secondary amino compound (CHEBI:50995) |
| gepotidacin (CHEBI:747127) is a tertiary amino compound (CHEBI:50996) |
| INNs | Source |
|---|---|
| gepotidacina | WHO MedNet |
| gepotidacine | WHO MedNet |
| Synonyms | Source |
|---|---|
| Gepotidacin | ChEMBL |
| GSK 2140944 | CAS |
| GSK-2140944 | ChEMBL |
| GSK2140944 | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| D10878 | KEGG DRUG |
| Gepotidacin | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:1075236-89-3 | CAS |
| Citations |
|---|