EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H21N3O3S |
| Net Charge | 0 |
| Average Mass | 335.429 |
| Monoisotopic Mass | 335.13036 |
| SMILES | CSCC[C@H](N)C(=O)N[C@@H](Cc1cnc2ccccc12)C(=O)O |
| InChI | InChI=1S/C16H21N3O3S/c1-23-7-6-12(17)15(20)19-14(16(21)22)8-10-9-18-13-5-3-2-4-11(10)13/h2-5,9,12,14,18H,6-8,17H2,1H3,(H,19,20)(H,21,22)/t12-,14-/m0/s1 |
| InChIKey | XYVRXLDSCKEYES-JSGCOSHPSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Met-Trp (CHEBI:74709) has role metabolite (CHEBI:25212) |
| Met-Trp (CHEBI:74709) is a dipeptide (CHEBI:46761) |
| Synonyms | Source |
|---|---|
| methionyltryptophan | ChEBI |
| Methionyl-tryptophan | ChemIDplus |
| MW | ChEBI |
| N-L-methionyl-L-tryptophan | ChemIDplus |
| L-Met-L-Trp | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0028984 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4884023 | Reaxys |
| CAS:60535-02-6 | ChemIDplus |