EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H20N2O3S |
| Net Charge | 0 |
| Average Mass | 296.392 |
| Monoisotopic Mass | 296.11946 |
| SMILES | CSCC[C@H](N)C(=O)N[C@@H](Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C14H20N2O3S/c1-20-8-7-11(15)13(17)16-12(14(18)19)9-10-5-3-2-4-6-10/h2-6,11-12H,7-9,15H2,1H3,(H,16,17)(H,18,19)/t11-,12-/m0/s1 |
| InChIKey | HGCNKOLVKRAVHD-RYUDHWBXSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Met-Phe (CHEBI:74708) has role metabolite (CHEBI:25212) |
| Met-Phe (CHEBI:74708) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| L-methionyl-L-phenylalanine |
| Synonyms | Source |
|---|---|
| methionylphenylalanine | ChEBI |
| Methionyl-Phenylalanine | HMDB |
| MF | ChEBI |
| L-Met-L-Phe | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0028980 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3620251 | Reaxys |
| CAS:14492-14-9 | ChemIDplus |