EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H23N3O3S |
| Net Charge | 0 |
| Average Mass | 277.390 |
| Monoisotopic Mass | 277.14601 |
| SMILES | CSCC[C@H](N)C(=O)N[C@@H](CCCCN)C(=O)O |
| InChI | InChI=1S/C11H23N3O3S/c1-18-7-5-8(13)10(15)14-9(11(16)17)4-2-3-6-12/h8-9H,2-7,12-13H2,1H3,(H,14,15)(H,16,17)/t8-,9-/m0/s1 |
| InChIKey | IMTUWVJPCQPJEE-IUCAKERBSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Met-Lys (CHEBI:74706) has role metabolite (CHEBI:25212) |
| Met-Lys (CHEBI:74706) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| L-methionyl-L-lysine |
| Synonyms | Source |
|---|---|
| MK | ChEBI |
| methionyllysine | ChEBI |
| L-Met-L-Lys | ChEBI |
| Methionyl-Lysine | HMDB |
| Manual Xrefs | Databases |
|---|---|
| HMDB0028978 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7094149 | Reaxys |