EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H22N2O3S |
| Net Charge | 0 |
| Average Mass | 262.375 |
| Monoisotopic Mass | 262.13511 |
| SMILES | CSCC[C@H](N)C(=O)N[C@@H](CC(C)C)C(=O)O |
| InChI | InChI=1S/C11H22N2O3S/c1-7(2)6-9(11(15)16)13-10(14)8(12)4-5-17-3/h7-9H,4-6,12H2,1-3H3,(H,13,14)(H,15,16)/t8-,9-/m0/s1 |
| InChIKey | PBOUVYGPDSARIS-IUCAKERBSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Met-Leu (CHEBI:74705) has role metabolite (CHEBI:25212) |
| Met-Leu (CHEBI:74705) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| L-methionyl-L-leucine |
| Synonyms | Source |
|---|---|
| methionylleucine | ChEBI |
| Methionyl-Leucine | HMDB |
| ML | ChEBI |
| L-Met-L-Leu | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0028977 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4252645 | Reaxys |