EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H18N4O3S |
| Net Charge | 0 |
| Average Mass | 286.357 |
| Monoisotopic Mass | 286.10996 |
| SMILES | CSCC[C@H](N)C(=O)N[C@@H](Cc1cncn1)C(=O)O |
| InChI | InChI=1S/C11H18N4O3S/c1-19-3-2-8(12)10(16)15-9(11(17)18)4-7-5-13-6-14-7/h5-6,8-9H,2-4,12H2,1H3,(H,13,14)(H,15,16)(H,17,18)/t8-,9-/m0/s1 |
| InChIKey | MWAYJIAKVUBKKP-IUCAKERBSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Met-His (CHEBI:74703) has role metabolite (CHEBI:25212) |
| Met-His (CHEBI:74703) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| L-methionyl-L-histidine |
| Synonyms | Source |
|---|---|
| methionylhistidine | ChEBI |
| Methionyl-Histidine | HMDB |
| MH | ChEBI |
| L-Met-L-His | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0028975 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10271237 | Reaxys |