EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H19N3O4S |
| Net Charge | 0 |
| Average Mass | 277.346 |
| Monoisotopic Mass | 277.10963 |
| SMILES | CSCC[C@H](N)C(=O)N[C@@H](CCC(N)=O)C(=O)O |
| InChI | InChI=1S/C10H19N3O4S/c1-18-5-4-6(11)9(15)13-7(10(16)17)2-3-8(12)14/h6-7H,2-5,11H2,1H3,(H2,12,14)(H,13,15)(H,16,17)/t6-,7-/m0/s1 |
| InChIKey | MUMXFARPYQTTSL-BQBZGAKWSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Met-Gln (CHEBI:74701) has role metabolite (CHEBI:25212) |
| Met-Gln (CHEBI:74701) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| L-methionyl-L-glutamine |
| Synonyms | Source |
|---|---|
| methionylglutamine | ChEBI |
| Methionyl-Glutamine | HMDB |
| MQ | ChEBI |
| L-Met-L-Gln | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0028971 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2383476 | Reaxys |