EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H22N4O3 |
| Net Charge | 0 |
| Average Mass | 378.432 |
| Monoisotopic Mass | 378.16919 |
| SMILES | CCOc1ncc(C)c2c1[C@H](c1ccc(C#N)cc1OC)C(C(N)=O)=C(C)N2 |
| InChI | InChI=1S/C21H22N4O3/c1-5-28-21-18-17(14-7-6-13(9-22)8-15(14)27-4)16(20(23)26)12(3)25-19(18)11(2)10-24-21/h6-8,10,17,25H,5H2,1-4H3,(H2,23,26)/t17-/m1/s1 |
| InChIKey | BTBHLEZXCOBLCY-QGZVFWFLSA-N |
| Roles Classification |
|---|
| Applications: | hypoglycemic agent A drug which lowers the blood glucose level. cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Finerenone (CHEBI:747008) has role cardiovascular drug (CHEBI:35554) |
| Finerenone (CHEBI:747008) has role hypoglycemic agent (CHEBI:35526) |
| Finerenone (CHEBI:747008) is a organic molecular entity (CHEBI:50860) |
| INN | Source |
|---|---|
| finerenona | WHO MedNet |
| Synonyms | Source |
|---|---|
| Bay94-8862 | ChEMBL |
| BAY 94-8862 | ChEMBL |
| BAY-94-8862 | ChEMBL |
| Finerenone | ChEMBL |
| Brand Name | Source |
|---|---|
| Kerendia | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| DB16165 | DrugBank |
| Registry Numbers | Sources |
|---|---|
| CAS:1050477-31-0 | KEGG DRUG |
| Citations |
|---|