EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:7470 - Naphazoline
| Formula | C14H14N2.HCl |
| Net Charge | 0 |
| Average Mass | 246.741 |
| Monoisotopic Mass | 246.09238 |
| SMILES | Cl.c1ccc2c(CC3=NCCN3)cccc2c1 |
| InChI | InChI=1S/C14H14N2.ClH/c1-2-7-13-11(4-1)5-3-6-12(13)10-14-15-8-9-16-14;/h1-7H,8-10H2,(H,15,16);1H |
| InChIKey | DJDFFEBSKJCGHC-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | antiviral agent A substance that destroys or inhibits replication of viruses. |
| Applications: | nasal decongestant A drug used to relieve nasal congestion in the upper respiratory tract. anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Naphazoline (CHEBI:7470) has role anti-inflammatory agent (CHEBI:67079) |
| Naphazoline (CHEBI:7470) has role antiviral agent (CHEBI:22587) |
| Naphazoline (CHEBI:7470) has role nasal decongestant (CHEBI:77715) |
| Naphazoline (CHEBI:7470) is a organic molecular entity (CHEBI:50860) |
| Synonyms | Source |
|---|---|
| naphazoline hydrochloride | ChEMBL |
| Naphazoline hydrochloride | KEGG COMPOUND |
| NSC-35711 | ChEMBL |
| Brand Names | Source |
|---|---|
| Albalon | ChEMBL |
| Antistin-privine | ChEMBL |
| Gppe nsl soln | ChEMBL |
| Nafazair | ChEMBL |
| Naphaz hcl | ChEMBL |
| Naphazoline hydrochloride component of naphcon-a | ChEMBL |
| Citations |
|---|