EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H16N2O5S |
| Net Charge | 0 |
| Average Mass | 264.303 |
| Monoisotopic Mass | 264.07799 |
| SMILES | CSCC[C@H](N)C(=O)N[C@@H](CC(=O)O)C(=O)O |
| InChI | InChI=1S/C9H16N2O5S/c1-17-3-2-5(10)8(14)11-6(9(15)16)4-7(12)13/h5-6H,2-4,10H2,1H3,(H,11,14)(H,12,13)(H,15,16)/t5-,6-/m0/s1 |
| InChIKey | QTZXSYBVOSXBEJ-WDSKDSINSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Met-Asp (CHEBI:74699) has role metabolite (CHEBI:25212) |
| Met-Asp (CHEBI:74699) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| L-methionyl-L-aspartic acid |
| Synonyms | Source |
|---|---|
| MD | ChEBI |
| Methionyl-Aspartate | HMDB |
| methionylaspartic acid | ChEBI |
| L-Met-L-Asp | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0028969 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7030634 | Reaxys |