EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H23N5O3S |
| Net Charge | 0 |
| Average Mass | 305.404 |
| Monoisotopic Mass | 305.15216 |
| SMILES | CSCC[C@H](N)C(=O)N[C@@H](CCCNC(=N)N)C(=O)O |
| InChI | InChI=1S/C11H23N5O3S/c1-20-6-4-7(12)9(17)16-8(10(18)19)3-2-5-15-11(13)14/h7-8H,2-6,12H2,1H3,(H,16,17)(H,18,19)(H4,13,14,15)/t7-,8-/m0/s1 |
| InChIKey | UASDAHIAHBRZQV-YUMQZZPRSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Met-Arg (CHEBI:74698) has role metabolite (CHEBI:25212) |
| Met-Arg (CHEBI:74698) is a dipeptide (CHEBI:46761) |
| Met-Arg (CHEBI:74698) is conjugate acid of Met-Arg(1+) (CHEBI:235406) |
| Incoming Relation(s) |
| Met-Arg(1+) (CHEBI:235406) is conjugate base of Met-Arg (CHEBI:74698) |
| IUPAC Name |
|---|
| L-methionyl-L-arginine |
| Synonyms | Source |
|---|---|
| methionylarginine | ChEBI |
| Methionyl-Arginine | HMDB |
| MR | ChEBI |
| L-Met-L-Arg | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0028967 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5759785 | Reaxys |