EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H15Cl2N3O3 |
| Net Charge | 0 |
| Average Mass | 392.242 |
| Monoisotopic Mass | 391.04905 |
| SMILES | Cc1noc(C)c1-c1cc(Cl)c(Nc2ccccc2C(=O)NO)c(Cl)c1 |
| InChI | InChI=1S/C18H15Cl2N3O3/c1-9-16(10(2)26-23-9)11-7-13(19)17(14(20)8-11)21-15-6-4-3-5-12(15)18(24)22-25/h3-8,21,25H,1-2H3,(H,22,24) |
| InChIKey | ILHNIWOZZKIBNW-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| FB23-2 (CHEBI:746967) has role antineoplastic agent (CHEBI:35610) |
| FB23-2 (CHEBI:746967) has role apoptosis inducer (CHEBI:68495) |
| FB23-2 (CHEBI:746967) is a dichlorobenzene (CHEBI:23697) |
| FB23-2 (CHEBI:746967) is a hydroxamic acid (CHEBI:24650) |
| FB23-2 (CHEBI:746967) is a isoxazoles (CHEBI:55373) |
| FB23-2 (CHEBI:746967) is a secondary amino compound (CHEBI:50995) |
| IUPAC Name |
|---|
| 2-[2,6-dichloro-4-(3,5-dimethyl-1,2-oxazol-4-yl)anilino]-N-hydroxybenzamide |
| Synonym | Source |
|---|---|
| 2-[[2,6-dichloro-4-(3,5-dimethyl-4-isoxazolyl)phenyl]amino]-N-hydroxybenzamide | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:2243736-45-8 | ChEBI |
| Citations |
|---|