EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H25F3N4O3 |
| Net Charge | 0 |
| Average Mass | 462.472 |
| Monoisotopic Mass | 462.18788 |
| SMILES | COc1cc2nc(C)nc(N[C@H](C)c3cc(N)cc(C(F)(F)F)c3)c2cc1O[C@H]1CCOC1 |
| InChI | InChI=1S/C23H25F3N4O3/c1-12(14-6-15(23(24,25)26)8-16(27)7-14)28-22-18-9-21(33-17-4-5-32-11-17)20(31-3)10-19(18)29-13(2)30-22/h6-10,12,17H,4-5,11,27H2,1-3H3,(H,28,29,30)/t12-,17+/m1/s1 |
| InChIKey | XVFDNRYZXDHTHT-PXAZEXFGSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| BI-3406 (CHEBI:746963) has role antineoplastic agent (CHEBI:35610) |
| BI-3406 (CHEBI:746963) is a (trifluoromethyl)benzenes (CHEBI:83565) |
| BI-3406 (CHEBI:746963) is a oxolanes (CHEBI:26912) |
| BI-3406 (CHEBI:746963) is a quinazolines (CHEBI:38530) |
| BI-3406 (CHEBI:746963) is a secondary amino compound (CHEBI:50995) |
| BI-3406 (CHEBI:746963) is a substituted aniline (CHEBI:48975) |
| IUPAC Name |
|---|
| N-{(1R)-1-[3-amino-5-(trifluoromethyl)phenyl]ethyl}-7-methoxy-2-methyl-6-{[(3S)-oxolan-3-yl]oxy}quinazolin-4-amine |
| Synonyms | Source |
|---|---|
| BI3406 | ChEBI |
| BI 3406 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:2230836-55-0 | ChEBI |
| Citations |
|---|