EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C33H31F3N6O2 |
| Net Charge | 0 |
| Average Mass | 600.645 |
| Monoisotopic Mass | 600.24606 |
| SMILES | C#Cc1c(F)ccc2cc(O)cc(-c3ncc4c(N5CC6CCC(C5)N6)nc(OC[C@@]56CCCN5C[C@H](F)C6)nc4c3F)c12 |
| InChI | InChI=1S/C33H31F3N6O2/c1-2-23-26(35)7-4-18-10-22(43)11-24(27(18)23)29-28(36)30-25(13-37-29)31(41-15-20-5-6-21(16-41)38-20)40-32(39-30)44-17-33-8-3-9-42(33)14-19(34)12-33/h1,4,7,10-11,13,19-21,38,43H,3,5-6,8-9,12,14-17H2/t19-,20?,21?,33+/m1/s1 |
| InChIKey | SCLLZBIBSFTLIN-IFMUVJFISA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| MRTX1133 (CHEBI:746962) has role antineoplastic agent (CHEBI:35610) |
| MRTX1133 (CHEBI:746962) is a naphthalenes (CHEBI:25477) |
| MRTX1133 (CHEBI:746962) is a pyridopyrimidine (CHEBI:38932) |
| IUPAC Name |
|---|
| 4-[4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-8-fluoro-2-{[(2R,7aS)-2-fluorotetrahydro-1H-pyrrolizin-7a(5H)-yl]methoxy}pyrido[4,3-d]pyrimidin-7-yl]-5-ethynyl-6-fluoronaphthalen-2-ol |
| Synonyms | Source |
|---|---|
| MRTX 1133 | ChEBI |
| MRTX-1133 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| MRTX1133 | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:2621928-55-8 | ChEBI |
| Citations |
|---|