EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H32O4 |
| Net Charge | 0 |
| Average Mass | 360.494 |
| Monoisotopic Mass | 360.23006 |
| SMILES | CC/C=C/C/C=C/CC(O)/C=C/C=C/C=C/C(O)C/C=C/CCC(=O)O |
| InChI | InChI=1S/C22H32O4/c1-2-3-4-5-6-10-15-20(23)16-11-7-8-12-17-21(24)18-13-9-14-19-22(25)26/h3-4,6-13,16-17,20-21,23-24H,2,5,14-15,18-19H2,1H3,(H,25,26)/b4-3+,8-7+,10-6+,13-9+,16-11+,17-12+ |
| InChIKey | HLHYXXBCQOUTGK-WXNJRXKZSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. specialised pro-resolving mediator A class of cell signaling molecules enzymatically derived from n-3 long chain polyunsaturated fatty acids that have important roles in orchestrating the resolution of tissue inflammation. |
| Application: | specialised pro-resolving mediator A class of cell signaling molecules enzymatically derived from n-3 long chain polyunsaturated fatty acids that have important roles in orchestrating the resolution of tissue inflammation. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7-Maresin 1 (CHEBI:746949) has role human xenobiotic metabolite (CHEBI:76967) |
| 7-Maresin 1 (CHEBI:746949) has role specialised pro-resolving mediator (CHEBI:140399) |
| 7-Maresin 1 (CHEBI:746949) is a dihydroxydocosahexaenoic acid (CHEBI:137348) |
| 7-Maresin 1 (CHEBI:746949) is a secondary allylic alcohol (CHEBI:134396) |
| Synonym | Source |
|---|---|
| 7-MaR1 | SUBMITTER |