EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H11N5O3 |
| Net Charge | 0 |
| Average Mass | 237.219 |
| Monoisotopic Mass | 237.08619 |
| SMILES | CC(O)C(O)c1cnc2c(=O)nc(N)nc2n1 |
| InChI | InChI=1S/C9H11N5O3/c1-3(15)6(16)4-2-11-5-7(12-4)13-9(10)14-8(5)17/h2-3,6,15-16H,1H3,(H3,10,12,13,14,17) |
| InChIKey | LNXRKRFGNHXANN-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| primapterin (CHEBI:74689) has role metabolite (CHEBI:25212) |
| primapterin (CHEBI:74689) is a biopterins (CHEBI:22881) |
| IUPAC Name |
|---|
| 2-amino-7-(1,2-dihydroxypropyl)pteridin-4(1H)-one |
| Synonyms | Source |
|---|---|
| 7-Isobiopterin | HMDB |
| 7-Biopterin | HMDB |
| Manual Xrefs | Databases |
|---|---|
| HMDB0002263 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:2582-88-9 | ChemIDplus |
| Citations |
|---|