EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H19N7O |
| Net Charge | 0 |
| Average Mass | 361.409 |
| Monoisotopic Mass | 361.16511 |
| SMILES | Cc1ccc2cc(N3CC[C@H](NC(=O)Cn4cnc(C#N)n4)C3)ccc2n1 |
| InChI | InChI=1S/C19H19N7O/c1-13-2-3-14-8-16(4-5-17(14)22-13)25-7-6-15(10-25)23-19(27)11-26-12-21-18(9-20)24-26/h2-5,8,12,15H,6-7,10-11H2,1H3,(H,23,27)/t15-/m0/s1 |
| InChIKey | BJRGHYFCLGZJCG-HNNXBMFYSA-N |
| Roles Classification |
|---|
| Biological Role: | antiprotozoal drug Any antimicrobial drug which is used to treat or prevent protozoal infections. |
| Application: | antiprotozoal drug Any antimicrobial drug which is used to treat or prevent protozoal infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| IID432 (CHEBI:746886) has role antiprotozoal drug (CHEBI:35820) |
| IID432 (CHEBI:746886) is a nitrile (CHEBI:18379) |
| IID432 (CHEBI:746886) is a pyrrolidines (CHEBI:38260) |
| IID432 (CHEBI:746886) is a quinolines (CHEBI:26513) |
| IID432 (CHEBI:746886) is a secondary carboxamide (CHEBI:140325) |
| IUPAC Name |
|---|
| 2-(3-cyano-1H-1,2,4-triazol-1-yl)-N-[(3S)-1-(2-methylquinolin-6-yl)pyrrolidin-3-yl]acetamide |
| Synonyms | Source |
|---|---|
| IID 432 | ChEBI |
| IID-432 | ChEBI |