EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H11N5O3 |
| Net Charge | 0 |
| Average Mass | 237.219 |
| Monoisotopic Mass | 237.08619 |
| SMILES | C[C@H](O)[C@@H](O)c1cnc2nc(N)nc(=O)c2n1 |
| InChI | InChI=1S/C9H11N5O3/c1-3(15)6(16)4-2-11-7-5(12-4)8(17)14-9(10)13-7/h2-3,6,15-16H,1H3,(H3,10,11,13,14,17)/t3-,6+/m0/s1 |
| InChIKey | LHQIJBMDNUYRAM-BBIVZNJYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| orinapterin (CHEBI:74688) has role metabolite (CHEBI:25212) |
| orinapterin (CHEBI:74688) is a biopterins (CHEBI:22881) |
| IUPAC Name |
|---|
| 2-amino-6-[(1S,2S)-1,2-dihydroxypropyl]pteridin-4(1H)-one |
| Synonyms | Source |
|---|---|
| 6-(L-threo-1,2-dihydroxypropyl)-pterin | MetaCyc |
| ciliapterin | MetaCyc |
| Manual Xrefs | Databases |
|---|---|
| CPD-15311 | MetaCyc |
| HMDB0000817 | HMDB |
| US2006127506 | Patent |
| Registry Numbers | Sources |
|---|---|
| CAS:13039-82-2 | HMDB |
| Citations |
|---|