EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H9NO2 |
| Net Charge | 0 |
| Average Mass | 103.121 |
| Monoisotopic Mass | 103.06333 |
| SMILES | CC(=O)NCCO |
| InChI | InChI=1S/C4H9NO2/c1-4(7)5-2-3-6/h6H,2-3H2,1H3,(H,5,7) |
| InChIKey | PVCJKHHOXFKFRP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-acetylethanolamine (CHEBI:74687) has role metabolite (CHEBI:25212) |
| N-acetylethanolamine (CHEBI:74687) is a acetamides (CHEBI:22160) |
| N-acetylethanolamine (CHEBI:74687) is a ethanolamines (CHEBI:23981) |
| N-acetylethanolamine (CHEBI:74687) is a monocarboxylic acid amide (CHEBI:29347) |
| IUPAC Name |
|---|
| N-(2-hydroxyethyl)acetamide |
| Manual Xrefs | Databases |
|---|---|
| CN101525301 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1811708 | Reaxys |
| CAS:142-26-7 | ChemIDplus |