EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H9NO2 |
| Net Charge | 0 |
| Average Mass | 151.165 |
| Monoisotopic Mass | 151.06333 |
| SMILES | CCc1cc(C(=O)O)ccn1 |
| InChI | InChI=1S/C8H9NO2/c1-2-7-5-6(8(10)11)3-4-9-7/h3-5H,2H2,1H3,(H,10,11) |
| InChIKey | YRCQSPCQYCXBJK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-ethylisonicotinic acid (CHEBI:74682) has functional parent isonicotinic acid (CHEBI:6032) |
| 2-ethylisonicotinic acid (CHEBI:74682) has role metabolite (CHEBI:25212) |
| 2-ethylisonicotinic acid (CHEBI:74682) is a pyridinemonocarboxylic acid (CHEBI:26420) |
| IUPAC Name |
|---|
| 2-ethylpyridine-4-carboxylic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:116470 | Reaxys |