EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H34O3 |
| Net Charge | 0 |
| Average Mass | 406.566 |
| Monoisotopic Mass | 406.25079 |
| SMILES | [H][C@@]12CCC3=CC(=O)CC[C@]3([H])[C@@]1([H])CC[C@]1(C)[C@@H](OC(=O)CCc3ccccc3)CC[C@@]21[H] |
| InChI | InChI=1S/C27H34O3/c1-27-16-15-22-21-11-9-20(28)17-19(21)8-10-23(22)24(27)12-13-25(27)30-26(29)14-7-18-5-3-2-4-6-18/h2-6,17,21-25H,7-16H2,1H3/t21-,22+,23+,24-,25-,27-/m0/s1 |
| InChIKey | UBWXUGDQUBIEIZ-QNTYDACNSA-N |
| Roles Classification |
|---|
| Biological Roles: | anabolic agent A compound which stimulates anabolism and inhibits catabolism. Anabolic agents stimulate the development of muscle mass, strength, and power. androgen A sex hormone that stimulates or controls the development and maintenance of masculine characteristics in vertebrates by binding to androgen receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nandrolone phenpropionate (CHEBI:7468) has functional parent nandrolone (CHEBI:7466) |
| nandrolone phenpropionate (CHEBI:7468) has role anabolic agent (CHEBI:36413) |
| nandrolone phenpropionate (CHEBI:7468) has role androgen (CHEBI:50113) |
| nandrolone phenpropionate (CHEBI:7468) is a 3-phenylpropionate ester (CHEBI:50791) |
| IUPAC Name |
|---|
| 3-oxoestr-4-en-17β-yl 3-phenylpropanoate |
| Synonyms | Source |
|---|---|
| 19NTPP | DrugBank |
| nadrolone phenylpropionate | DrugBank |
| Nandrolone phenpropionate | KEGG COMPOUND |
| nandrolone phenylpionate | DrugBank |
| Nandrolone phenylpropionate | KEGG COMPOUND |
| nandrolon phenylpropionate | DrugBank |
| Brand Name | Source |
|---|---|
| Durabolin | KEGG DRUG |