EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H17F2N3O6 |
| Net Charge | 0 |
| Average Mass | 517.444 |
| Monoisotopic Mass | 517.10854 |
| SMILES | C=CCN1C(=O)[C@@]2(c3cccc(F)c31)c1c(c3cc(F)ccc3oc1=O)Oc1nc(C)n(C(C)=O)c(=O)c12 |
| InChI | InChI=1S/C27H17F2N3O6/c1-4-10-31-21-16(6-5-7-17(21)29)27(26(31)36)19-22(15-11-14(28)8-9-18(15)37-25(19)35)38-23-20(27)24(34)32(13(3)33)12(2)30-23/h4-9,11H,1,10H2,2-3H3/t27-/m0/s1 |
| InChIKey | WVKHBHOIOXXGLG-MHZLTWQESA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| JP-8g (CHEBI:74654) has role antineoplastic agent (CHEBI:35610) |
| JP-8g (CHEBI:74654) is a organic heterohexacyclic compound (CHEBI:51914) |
| JP-8g (CHEBI:74654) is a organofluorine compound (CHEBI:37143) |
| JP-8g (CHEBI:74654) is a oxindoles (CHEBI:38459) |
| JP-8g (CHEBI:74654) is a spiro compound (CHEBI:33599) |
| IUPAC Name |
|---|
| (7R)-9-acetyl-1'-allyl-2,7'-difluoro-10-methyl-6H-spiro[chromeno[3',4':5,6]pyrano[2,3-d]pyrimidine-7,3'-indole]-2',6,8(1'H,9H)-trione |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22422170 | Reaxys |