EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H23NO4 |
| Net Charge | 0 |
| Average Mass | 341.407 |
| Monoisotopic Mass | 341.16271 |
| SMILES | O=C1CC[C@@]2(O)[C@H]3Cc4ccc(O)c5c4[C@@]2(CCN3CC2CC2)[C@H]1O5 |
| InChI | InChI=1S/C20H23NO4/c22-13-4-3-12-9-15-20(24)6-5-14(23)18-19(20,16(12)17(13)25-18)7-8-21(15)10-11-1-2-11/h3-4,11,15,18,22,24H,1-2,5-10H2/t15-,18+,19+,20-/m1/s1 |
| InChIKey | DQCKKXVULJGBQN-XFWGSAIBSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| Biological Roles: | mu-opioid receptor antagonist Any compound that exhibits antagonist activity at the μ-opioid receptor xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| Applications: | antidote to opioid poisoning A role borne by a molecule that acts to counteract or neutralise the deleterious effects of opioids. mu-opioid receptor antagonist Any compound that exhibits antagonist activity at the μ-opioid receptor central nervous system depressant A loosely defined group of drugs that tend to reduce the activity of the central nervous system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| naltrexone (CHEBI:7465) has role antidote to opioid poisoning (CHEBI:90755) |
| naltrexone (CHEBI:7465) has role central nervous system depressant (CHEBI:35488) |
| naltrexone (CHEBI:7465) has role environmental contaminant (CHEBI:78298) |
| naltrexone (CHEBI:7465) has role xenobiotic (CHEBI:35703) |
| naltrexone (CHEBI:7465) has role μ-opioid receptor antagonist (CHEBI:50137) |
| naltrexone (CHEBI:7465) is a cyclopropanes (CHEBI:51454) |
| naltrexone (CHEBI:7465) is a morphinane-like compound (CHEBI:83818) |
| naltrexone (CHEBI:7465) is a organic heteropentacyclic compound (CHEBI:38164) |
| naltrexone (CHEBI:7465) is conjugate base of naltrexone(1+) (CHEBI:134688) |
| Incoming Relation(s) |
| naltrexone(1+) (CHEBI:134688) is conjugate acid of naltrexone (CHEBI:7465) |
| IUPAC Name |
|---|
| 3,14-dihydroxy-17-(cyclopropylmethyl)-4,5α-epoxymorphinan-6-one |
| INN | Source |
|---|---|
| naltrexone | ChemIDplus |
| Synonyms | Source |
|---|---|
| 17-(Cyclopropylmethyl)-4,5-epoxy-3,14-dihydroxymorphinan-6-one | ChemIDplus |
| 17-(Cyclopropylmethyl)-4,5α-epoxy-3,14-dihydroxymorphinan-6-one | ChemIDplus |
| N-Cyclopropylmethyl-14-hydroxydihydromorphinone | ChemIDplus |
| N-Cyclopropylmethylnoroxymorphone | ChemIDplus |
| Naltrexone | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| 1765 | DrugCentral |
| C07253 | KEGG COMPOUND |
| D05113 | KEGG DRUG |
| DB00704 | DrugBank |
| HMDB0014842 | HMDB |
| LSM-3962 | LINCS |
| Naltrexone | Wikipedia |
| US3332950 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3596648 | Reaxys |
| CAS:16590-41-3 | KEGG COMPOUND |
| CAS:16590-41-3 | ChemIDplus |
| CAS:16590-41-3 | NIST Chemistry WebBook |
| Citations |
|---|