EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H14N2O3 |
| Net Charge | 0 |
| Average Mass | 246.266 |
| Monoisotopic Mass | 246.10044 |
| SMILES | CC(=O)N[C@@H](Cc1cnc2ccccc12)C(=O)O |
| InChI | InChI=1S/C13H14N2O3/c1-8(16)15-12(13(17)18)6-9-7-14-11-5-3-2-4-10(9)11/h2-5,7,12,14H,6H2,1H3,(H,15,16)(H,17,18)/t12-/m0/s1 |
| InChIKey | DZTHIGRZJZPRDV-LBPRGKRZSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-acetyl-L-tryptophan (CHEBI:74640) has role metabolite (CHEBI:25212) |
| N-acetyl-L-tryptophan (CHEBI:74640) is a N-acetyl-L-amino acid (CHEBI:21545) |
| N-acetyl-L-tryptophan (CHEBI:74640) is a L-tryptophan derivative (CHEBI:47994) |
| N-acetyl-L-tryptophan (CHEBI:74640) is conjugate acid of N-acetyl-L-tryptophanate (CHEBI:143877) |
| N-acetyl-L-tryptophan (CHEBI:74640) is enantiomer of N-acetyl-D-tryptophan (CHEBI:16734) |
| Incoming Relation(s) |
| N-acetyl-L-tryptophanate (CHEBI:143877) is conjugate base of N-acetyl-L-tryptophan (CHEBI:74640) |
| N-acetyl-D-tryptophan (CHEBI:16734) is enantiomer of N-acetyl-L-tryptophan (CHEBI:74640) |
| IUPAC Name |
|---|
| N-acetyl-L-tryptophan |
| Manual Xrefs | Databases |
|---|---|
| HMDB0013713 | HMDB |
| LSM-19010 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:89476 | Reaxys |
| CAS:1218-34-4 | ChemIDplus |
| Citations |
|---|