EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H26N5O6P |
| Net Charge | 0 |
| Average Mass | 427.398 |
| Monoisotopic Mass | 427.16207 |
| SMILES | CO[C@H]1[C@@H](O)[C@H](n2cnc3c(NCC=C(C)C)ncnc32)O[C@@H]1COP(C)(=O)O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N6-dimethylallyladenine 5'-monophosphate residue (CHEBI:74638) is a nucleotide residue (CHEBI:50319) |
| N6-dimethylallyladenine 5'-monophosphate residue (CHEBI:74638) is conjugate acid of N6-dimethylallyladenine 5'-monophosphate(1−) residue (CHEBI:74415) |
| N6-dimethylallyladenine 5'-monophosphate residue (CHEBI:74638) is substituent group from N6-(dimethylallyl)adenosine 5'-monophosphate (CHEBI:15819) |
| Incoming Relation(s) |
| N6-dimethylallyladenine 5'-monophosphate(1−) residue (CHEBI:74415) is conjugate base of N6-dimethylallyladenine 5'-monophosphate residue (CHEBI:74638) |
| Synonyms | Source |
|---|---|
| N6-dimethylallyl-5'-adenylyl residue | ChEBI |
| N6-dimethylallyl-AMP residue | ChEBI |