EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H25NO3 |
| Net Charge | 0 |
| Average Mass | 339.435 |
| Monoisotopic Mass | 339.18344 |
| SMILES | C=C1CC[C@@]2(O)[C@H]3Cc4ccc(O)c5c4[C@@]2(CCN3CC2CC2)[C@H]1O5 |
| InChI | InChI=1S/C21H25NO3/c1-12-6-7-21(24)16-10-14-4-5-15(23)18-17(14)20(21,19(12)25-18)8-9-22(16)11-13-2-3-13/h4-5,13,16,19,23-24H,1-3,6-11H2/t16-,19+,20+,21-/m1/s1 |
| InChIKey | WJBLNOPPDWQMCH-MBPVOVBZSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Nalmefene (CHEBI:7457) is a morphinane alkaloid (CHEBI:25418) |
| Synonyms | Source |
|---|---|
| 6-desoxy-6-methylenenaltrexone | DrugCentral |
| Nalmefene | KEGG COMPOUND |
| nalmefene HCl | DrugCentral |
| nalmefene hydrochloride | DrugCentral |
| nalmefene hydrochloride dihydrate | DrugCentral |
| nalmetrene | DrugCentral |