EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H19N3O4 |
| Net Charge | 0 |
| Average Mass | 233.268 |
| Monoisotopic Mass | 233.13756 |
| SMILES | NCCCC[C@H](N)C(=O)N[C@@H](CO)C(=O)O |
| InChI | InChI=1S/C9H19N3O4/c10-4-2-1-3-6(11)8(14)12-7(5-13)9(15)16/h6-7,13H,1-5,10-11H2,(H,12,14)(H,15,16)/t6-,7-/m0/s1 |
| InChIKey | YSZNURNVYFUEHC-BQBZGAKWSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Lys-Ser (CHEBI:74568) has role metabolite (CHEBI:25212) |
| Lys-Ser (CHEBI:74568) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| L-lysyl-L-serine |
| Synonyms | Source |
|---|---|
| L-Lys-L-Ser | ChEBI |
| lysylserine | ChEBI |
| KS | ChEBI |
| Lysyl-Serine | HMDB |
| Manual Xrefs | Databases |
|---|---|
| HMDB0028960 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2457960 | Reaxys |
| CAS:6665-19-6 | ChemIDplus |