EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H21N3O3 |
| Net Charge | 0 |
| Average Mass | 243.307 |
| Monoisotopic Mass | 243.15829 |
| SMILES | NCCCC[C@H](N)C(=O)N1CCC[C@H]1C(=O)O |
| InChI | InChI=1S/C11H21N3O3/c12-6-2-1-4-8(13)10(15)14-7-3-5-9(14)11(16)17/h8-9H,1-7,12-13H2,(H,16,17)/t8-,9-/m0/s1 |
| InChIKey | AIXUQKMMBQJZCU-IUCAKERBSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Lys-Pro (CHEBI:74567) has role metabolite (CHEBI:25212) |
| Lys-Pro (CHEBI:74567) is a dipeptide (CHEBI:46761) |
| Lys-Pro (CHEBI:74567) is conjugate base of Lys-Pro(1+) (CHEBI:190703) |
| Incoming Relation(s) |
| Lys-Pro(1+) (CHEBI:190703) is conjugate acid of Lys-Pro (CHEBI:74567) |
| IUPAC Name |
|---|
| L-lysyl-L-proline |
| Synonyms | Source |
|---|---|
| KP | ChEBI |
| lysylproline | ChEBI |
| Lysyl-Proline | ChEBI |
| L-Lys-L-Pro | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0028959 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5556824 | Reaxys |
| CAS:52766-27-5 | ChemIDplus |
| Citations |
|---|