EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H26N4O3 |
| Net Charge | 0 |
| Average Mass | 274.365 |
| Monoisotopic Mass | 274.20049 |
| SMILES | NCCCC[C@H](NC(=O)[C@@H](N)CCCCN)C(=O)O |
| InChI | InChI=1S/C12H26N4O3/c13-7-3-1-5-9(15)11(17)16-10(12(18)19)6-2-4-8-14/h9-10H,1-8,13-15H2,(H,16,17)(H,18,19)/t9-,10-/m0/s1 |
| InChIKey | NVGBPTNZLWRQSY-UWVGGRQHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mycoplasma genitalium (ncbitaxon:2097) | - | PubMed (22817898) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | Mycoplasma genitalium metabolite Any bacterial metabolite produced during a metabolic reaction in Mycoplasma genitalium. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Lys-Lys (CHEBI:74564) has role Mycoplasma genitalium metabolite (CHEBI:131604) |
| Lys-Lys (CHEBI:74564) is a dipeptide (CHEBI:46761) |
| Lys-Lys (CHEBI:74564) is conjugate base of Lys-Lys(2+) (CHEBI:229956) |
| Incoming Relation(s) |
| Lys-Lys(2+) (CHEBI:229956) is conjugate acid of Lys-Lys (CHEBI:74564) |
| IUPAC Name |
|---|
| L-lysyl-L-lysine |
| Synonyms | Source |
|---|---|
| dilysine | ChEBI |
| H-Lys-Lys-OH | ChEBI |
| H-L-Lys-L-Lys-OH | ChEBI |
| K-K | ChEBI |
| KK | ChEBI |
| KK dipeptide | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0028956 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1729029 | Reaxys |
| CAS:13184-13-9 | ChemIDplus |
| Citations |
|---|