EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H25N3O3 |
| Net Charge | 0 |
| Average Mass | 259.350 |
| Monoisotopic Mass | 259.18959 |
| SMILES | CC(C)C[C@H](NC(=O)[C@@H](N)CCCCN)C(=O)O |
| InChI | InChI=1S/C12H25N3O3/c1-8(2)7-10(12(17)18)15-11(16)9(14)5-3-4-6-13/h8-10H,3-7,13-14H2,1-2H3,(H,15,16)(H,17,18)/t9-,10-/m0/s1 |
| InChIKey | ATIPDCIQTUXABX-UWVGGRQHSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Lys-Leu (CHEBI:74561) has role metabolite (CHEBI:25212) |
| Lys-Leu (CHEBI:74561) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| L-lysyl-L-leucine |
| Synonyms | Source |
|---|---|
| KL | ChEBI |
| lysylleucine | ChEBI |
| Lysyl-Leucine | HMDB |
| L-Lys-L-Leu | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0028955 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2377223 | Reaxys |
| Citations |
|---|