EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H26N6O3 |
| Net Charge | 0 |
| Average Mass | 302.379 |
| Monoisotopic Mass | 302.20664 |
| SMILES | N=C(N)NCCC[C@H](NC(=O)[C@@H](N)CCCCN)C(=O)O |
| InChI | InChI=1S/C12H26N6O3/c13-6-2-1-4-8(14)10(19)18-9(11(20)21)5-3-7-17-12(15)16/h8-9H,1-7,13-14H2,(H,18,19)(H,20,21)(H4,15,16,17)/t8-,9-/m0/s1 |
| InChIKey | NPBGTPKLVJEOBE-IUCAKERBSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Lys-Arg (CHEBI:74553) has role metabolite (CHEBI:25212) |
| Lys-Arg (CHEBI:74553) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| L-lysyl-L-arginine |
| Synonyms | Source |
|---|---|
| L-Lys-L-Arg | ChEBI |
| lysylarginine | ChEBI |
| KR | ChEBI |
| Lysyl-Arginine | HMDB |
| Manual Xrefs | Databases |
|---|---|
| HMDB0028945 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1716491 | Reaxys |