EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H7ClN2O3 |
| Net Charge | 0 |
| Average Mass | 178.575 |
| Monoisotopic Mass | 178.01452 |
| SMILES | [H][C@@]1([C@H](N)C(=O)O)CC(Cl)=NO1 |
| InChI | InChI=1S/C5H7ClN2O3/c6-3-1-2(11-8-3)4(7)5(9)10/h2,4H,1,7H2,(H,9,10)/t2-,4-/m0/s1 |
| InChIKey | QAWIHIJWNYOLBE-OKKQSCSOSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antimetabolite A substance which is structurally similar to a metabolite but which competes with it or replaces it, and so prevents or reduces its normal utilization. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. glutamine antagonist An antagonist that acts on glutamine receptors. EC 2.3.2.2 (gamma-glutamyltransferase) inhibitor An EC 2.3.2.* (aminoacyltransferase) inhibitor that interferes with the action of γ-glutamyltransferase (EC 2.3.2.2). antileishmanial agent An antiprotozoal drug used to treat or prevent infections caused by protozoan parasites that belong to the genus Leishmania. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. antileishmanial agent An antiprotozoal drug used to treat or prevent infections caused by protozoan parasites that belong to the genus Leishmania. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| acivicin (CHEBI:74545) has role antileishmanial agent (CHEBI:70868) |
| acivicin (CHEBI:74545) has role antimetabolite (CHEBI:35221) |
| acivicin (CHEBI:74545) has role antimicrobial agent (CHEBI:33281) |
| acivicin (CHEBI:74545) has role antineoplastic agent (CHEBI:35610) |
| acivicin (CHEBI:74545) has role EC 2.3.2.2 (γ-glutamyltransferase) inhibitor (CHEBI:74570) |
| acivicin (CHEBI:74545) has role glutamine antagonist (CHEBI:138931) |
| acivicin (CHEBI:74545) has role metabolite (CHEBI:25212) |
| acivicin (CHEBI:74545) is a isoxazoles (CHEBI:55373) |
| acivicin (CHEBI:74545) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| acivicin (CHEBI:74545) is a organochlorine compound (CHEBI:36683) |
| IUPAC Name |
|---|
| (2S)-amino[(5S)-3-chloro-4,5-dihydro-1,2-oxazol-5-yl]acetic acid |
| INNs | Source |
|---|---|
| acivicin | ChemIDplus |
| acivicina | WHO MedNet |
| acivicine | ChemIDplus |
| acivicino | ChemIDplus |
| acivicinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| Antibiotic AT 125 | ChemIDplus |
| AT 125 | ChemIDplus |
| AT-125 | ChemIDplus |
| NSC 163501 | ChemIDplus |
| NSC-163501 | ChemIDplus |
| U 42,126 | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1074649 | Reaxys |
| CAS:42228-92-2 | ChemIDplus |
| Citations |
|---|