EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H7ClN2O3 |
| Net Charge | 0 |
| Average Mass | 178.575 |
| Monoisotopic Mass | 178.01452 |
| SMILES | [H][C@@]1([C@H](N)C(=O)O)CC(Cl)=NO1 |
| InChI | InChI=1S/C5H7ClN2O3/c6-3-1-2(11-8-3)4(7)5(9)10/h2,4H,1,7H2,(H,9,10)/t2-,4-/m0/s1 |
| InChIKey | QAWIHIJWNYOLBE-OKKQSCSOSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | antileishmanial agent An antiprotozoal drug used to treat or prevent infections caused by protozoan parasites that belong to the genus Leishmania. glutamine antagonist An antagonist that acts on glutamine receptors. antimetabolite A substance which is structurally similar to a metabolite but which competes with it or replaces it, and so prevents or reduces its normal utilization. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. EC 2.3.2.2 (gamma-glutamyltransferase) inhibitor An EC 2.3.2.* (aminoacyltransferase) inhibitor that interferes with the action of γ-glutamyltransferase (EC 2.3.2.2). |
| Applications: | antileishmanial agent An antiprotozoal drug used to treat or prevent infections caused by protozoan parasites that belong to the genus Leishmania. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| acivicin (CHEBI:74545) has role antileishmanial agent (CHEBI:70868) |
| acivicin (CHEBI:74545) has role antimetabolite (CHEBI:35221) |
| acivicin (CHEBI:74545) has role antimicrobial agent (CHEBI:33281) |
| acivicin (CHEBI:74545) has role antineoplastic agent (CHEBI:35610) |
| acivicin (CHEBI:74545) has role EC 2.3.2.2 (γ-glutamyltransferase) inhibitor (CHEBI:74570) |
| acivicin (CHEBI:74545) has role glutamine antagonist (CHEBI:138931) |
| acivicin (CHEBI:74545) has role metabolite (CHEBI:25212) |
| acivicin (CHEBI:74545) is a isoxazoles (CHEBI:55373) |
| acivicin (CHEBI:74545) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| acivicin (CHEBI:74545) is a organochlorine compound (CHEBI:36683) |
| IUPAC Name |
|---|
| (2S)-amino[(5S)-3-chloro-4,5-dihydro-1,2-oxazol-5-yl]acetic acid |
| INNs | Source |
|---|---|
| acivicin | ChemIDplus |
| acivicine | ChemIDplus |
| acivicino | ChemIDplus |
| acivicinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| Antibiotic AT 125 | ChemIDplus |
| AT 125 | ChemIDplus |
| AT-125 | ChemIDplus |
| NSC 163501 | ChemIDplus |
| NSC-163501 | ChemIDplus |
| U 42126 | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1074649 | Reaxys |
| CAS:42228-92-2 | ChemIDplus |
| Citations |
|---|