EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H13Cl3O6 |
| Net Charge | 0 |
| Average Mass | 311.545 |
| Monoisotopic Mass | 309.97777 |
| SMILES | OC[C@H]1O[C@@H](OCC(Cl)(Cl)Cl)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C8H13Cl3O6/c9-8(10,11)2-16-7-6(15)5(14)4(13)3(1-12)17-7/h3-7,12-15H,1-2H2/t3-,4-,5+,6-,7-/m1/s1 |
| InChIKey | JMIZQJXRDKPSKP-XUUWZHRGSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| trichloroethyl β-D-glucoside (CHEBI:74542) has role metabolite (CHEBI:25212) |
| trichloroethyl β-D-glucoside (CHEBI:74542) is a organochlorine compound (CHEBI:36683) |
| trichloroethyl β-D-glucoside (CHEBI:74542) is a β-D-glucoside (CHEBI:22798) |
| IUPAC Name |
|---|
| 2,2,2-trichloroethyl β-D-glucopyranoside |
| Synonym | Source |
|---|---|
| 2,2,2-trichloroethyl β-D-glucoside | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| CPD-9676 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11756 | Reaxys |