EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H35N3O4 |
| Net Charge | 0 |
| Average Mass | 357.495 |
| Monoisotopic Mass | 357.26276 |
| SMILES | CC(C)C[C@H](NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](N)CC(C)C)C(=O)O |
| InChI | InChI=1S/C18H35N3O4/c1-10(2)7-13(19)16(22)20-14(8-11(3)4)17(23)21-15(18(24)25)9-12(5)6/h10-15H,7-9,19H2,1-6H3,(H,20,22)(H,21,23)(H,24,25)/t13-,14-,15-/m0/s1 |
| InChIKey | DNDWZFHLZVYOGF-KKUMJFAQSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Leu-Leu-Leu (CHEBI:74541) has role metabolite (CHEBI:25212) |
| Leu-Leu-Leu (CHEBI:74541) is a tripeptide (CHEBI:47923) |
| Synonyms | Source |
|---|---|
| leucylleucylleucine | ChEBI |
| Leucyl-leucyl-leucine | ChemIDplus |
| LLL | ChEBI |
| L-Leu-L-Leu-L-Leu | ChEBI |
| Trileucine | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2478337 | Reaxys |
| CAS:10329-75-6 | ChemIDplus |