EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H16N2O3 |
| Net Charge | 0 |
| Average Mass | 188.227 |
| Monoisotopic Mass | 188.11609 |
| SMILES | CC(C)C[C@H](N)C(=O)NCC(=O)O |
| InChI | InChI=1S/C8H16N2O3/c1-5(2)3-6(9)8(13)10-4-7(11)12/h5-6H,3-4,9H2,1-2H3,(H,10,13)(H,11,12)/t6-/m0/s1 |
| InChIKey | LESXFEZIFXFIQR-LURJTMIESA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Leu-Gly (CHEBI:74534) has role metabolite (CHEBI:25212) |
| Leu-Gly (CHEBI:74534) is a dipeptide (CHEBI:46761) |
| Leu-Gly (CHEBI:74534) is tautomer of Leu-Gly zwitterion (CHEBI:133658) |
| Incoming Relation(s) |
| Leu-Gly zwitterion (CHEBI:133658) is tautomer of Leu-Gly (CHEBI:74534) |
| IUPAC Name |
|---|
| L-leucylglycine |
| Synonyms | Source |
|---|---|
| leucylglycine | ChEBI |
| Leucyl-Glycine | ChEBI |
| LG | ChEBI |
| N-L-Leucylglycine | ChemIDplus |
| L-Leu-Gly | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0028929 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1725452 | Reaxys |
| CAS:686-50-0 | ChemIDplus |