EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H21N.HCl |
| Net Charge | 0 |
| Average Mass | 323.867 |
| Monoisotopic Mass | 323.14408 |
| SMILES | CN(C/C=C/c1ccccc1)Cc1cccc2ccccc12.Cl |
| InChI | InChI=1S/C21H21N.ClH/c1-22(16-8-11-18-9-3-2-4-10-18)17-20-14-7-13-19-12-5-6-15-21(19)20;/h2-15H,16-17H2,1H3;1H/b11-8+; |
| InChIKey | OLUNPKFOFGZHRT-YGCVIUNWSA-N |
| Roles Classification |
|---|
| Biological Roles: | antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. |
| Application: | antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Naftifine hydrochloride (CHEBI:7452) has role antifungal agent (CHEBI:35718) |
| Naftifine hydrochloride (CHEBI:7452) is a allylamine antifungal drug (CHEBI:87127) |
| Naftifine hydrochloride (CHEBI:7452) is a hydrochloride (CHEBI:36807) |
| Synonyms | Source |
|---|---|
| AW 105-843 | ChEMBL |
| NAFT-900 | ChEMBL |
| NAFT900 | ChEMBL |
| Naftifine hydrochloride | KEGG COMPOUND |
| NSC-760068 | ChEMBL |
| Brand Name | Source |
|---|---|
| Naftin | ChEMBL |
| Citations |
|---|