EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H21N.HCl |
| Net Charge | 0 |
| Average Mass | 323.867 |
| Monoisotopic Mass | 323.14408 |
| SMILES | CN(C/C=C/c1ccccc1)Cc1cccc2ccccc12.Cl |
| InChI | InChI=1S/C21H21N.ClH/c1-22(16-8-11-18-9-3-2-4-10-18)17-20-14-7-13-19-12-5-6-15-21(19)20;/h2-15H,16-17H2,1H3;1H/b11-8+; |
| InChIKey | OLUNPKFOFGZHRT-YGCVIUNWSA-N |
| Roles Classification |
|---|
| Biological Role: | antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. |
| Application: | antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Naftifine hydrochloride (CHEBI:7452) is a allylamine antifungal drug (CHEBI:87127) |
| Naftifine hydrochloride (CHEBI:7452) is a hydrochloride (CHEBI:36807) |
| Synonym | Source |
|---|---|
| Naftifine hydrochloride | KEGG COMPOUND |