EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H21N |
| Net Charge | 0 |
| Average Mass | 287.406 |
| Monoisotopic Mass | 287.16740 |
| SMILES | CN(C/C=C/c1ccccc1)Cc1cccc2ccccc12 |
| InChI | InChI=1S/C21H21N/c1-22(16-8-11-18-9-3-2-4-10-18)17-20-14-7-13-19-12-5-6-15-21(19)20/h2-15H,16-17H2,1H3/b11-8+ |
| InChIKey | OZGNYLLQHRPOBR-DHZHZOJOSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | sterol biosynthesis inhibitor Any compound that inhibits the biosynthesis of any sterol. EC 1.14.13.132 (squalene monooxygenase) inhibitor An EC 1.14.13.* (oxidoreductase acting on paired donors, incorporating 1 atom of oxygen, with NADH or NADPH as one donor) inhibitor that interferes with the action of squalene monooxygenase (EC 1.14.13.132). antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. |
| Application: | antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| naftifine (CHEBI:7451) has role EC 1.14.13.132 (squalene monooxygenase) inhibitor (CHEBI:59285) |
| naftifine (CHEBI:7451) has role sterol biosynthesis inhibitor (CHEBI:83317) |
| naftifine (CHEBI:7451) is a allylamine antifungal drug (CHEBI:87127) |
| naftifine (CHEBI:7451) is a naphthalenes (CHEBI:25477) |
| naftifine (CHEBI:7451) is a tertiary amine (CHEBI:32876) |
| IUPAC Name |
|---|
| (2E)-N-methyl-N-(1-naphthylmethyl)-3-phenylprop-2-en-1-amine |
| INNs | Source |
|---|---|
| naftifina | WHO MedNet |
| naftifine | WHO MedNet |
| naftifine | KEGG DRUG |
| naftifinum | WHO MedNet |
| Synonyms | Source |
|---|---|
| (E)-N-cinnamyl-N-methyl-1-naphthalenemethylamine | ChemIDplus |
| trans-N-cinnamyl-N-methyl-(1-naphthylmethyl)amine | ChEBI |
| naftifin | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2983617 | Reaxys |
| CAS:65472-88-0 | KEGG COMPOUND |
| CAS:65472-88-0 | ChemIDplus |
| Citations |
|---|