EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H21N3O6 |
| Net Charge | 0 |
| Average Mass | 315.326 |
| Monoisotopic Mass | 315.14304 |
| SMILES | COC(=O)/C=C/C(=O)NCC(N)C(=O)N[C@H](C(=O)O)C(C)C |
| InChI | InChI=1S/C13H21N3O6/c1-7(2)11(13(20)21)16-12(19)8(14)6-15-9(17)4-5-10(18)22-3/h4-5,7-8,11H,6,14H2,1-3H3,(H,15,17)(H,16,19)(H,20,21)/b5-4+/t8?,11-/m0/s1 |
| InChIKey | JRYYPGRGZBRRME-FPWJMTENSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Val-FMDP (CHEBI:74509) has functional parent L-valine (CHEBI:16414) |
| Val-FMDP (CHEBI:74509) has functional parent 3-aminoalanine (CHEBI:18383) |
| Val-FMDP (CHEBI:74509) has role metabolite (CHEBI:25212) |
| Val-FMDP (CHEBI:74509) is a dicarboxylic acid monoester (CHEBI:36244) |
| Val-FMDP (CHEBI:74509) is a dipeptide (CHEBI:46761) |
| Val-FMDP (CHEBI:74509) is a methyl ester (CHEBI:25248) |
| IUPAC Names |
|---|
| (2S)-2-[(2-amino-3-{[(2E)-4-methoxy-4-oxobut-2-enoyl]amino}propanoyl)amino]-3-methylbutanoic acid |
| 3-{[(2E)-4-methoxy-4-oxobut-2-enoyl]amino}alanyl-L-valine |
| Manual Xrefs | Databases |
|---|---|
| CPD0-1911 | MetaCyc |