EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H21N3O7 |
| Net Charge | 0 |
| Average Mass | 379.369 |
| Monoisotopic Mass | 379.13795 |
| SMILES | COC(=O)/C=C/C(=O)NCC(NC(=O)[C@@H](N)Cc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C17H21N3O7/c1-27-15(23)7-6-14(22)19-9-13(17(25)26)20-16(24)12(18)8-10-2-4-11(21)5-3-10/h2-7,12-13,21H,8-9,18H2,1H3,(H,19,22)(H,20,24)(H,25,26)/b7-6+/t12-,13?/m0/s1 |
| InChIKey | GHFSCLVMNYRWQP-LOJZCDLVSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Tyr-FMDP (CHEBI:74501) has functional parent L-tyrosine (CHEBI:17895) |
| Tyr-FMDP (CHEBI:74501) has functional parent 3-aminoalanine (CHEBI:18383) |
| Tyr-FMDP (CHEBI:74501) has role metabolite (CHEBI:25212) |
| Tyr-FMDP (CHEBI:74501) is a dicarboxylic acid monoester (CHEBI:36244) |
| Tyr-FMDP (CHEBI:74501) is a dipeptide (CHEBI:46761) |
| Tyr-FMDP (CHEBI:74501) is a methyl ester (CHEBI:25248) |
| IUPAC Names |
|---|
| 2-{[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]amino}-3-{[(2E)-4-methoxy-4-oxobut-2-enoyl]amino}propanoic acid |
| L-tyrosyl-3-{[(2E)-4-methoxy-4-oxobut-2-enoyl]amino}alanine |
| Manual Xrefs | Databases |
|---|---|
| CPD0-1913 | MetaCyc |