EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H7Cl2NO |
| Net Charge | 0 |
| Average Mass | 228.078 |
| Monoisotopic Mass | 226.99047 |
| SMILES | Cc1ccc2c(Cl)cc(Cl)c(O)c2n1 |
| InChI | InChI=1S/C10H7Cl2NO/c1-5-2-3-6-7(11)4-8(12)10(14)9(6)13-5/h2-4,14H,1H3 |
| InChIKey | GPTXWRGISTZRIO-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antibacterial drug A drug used to treat or prevent bacterial infections. antiprotozoal drug Any antimicrobial drug which is used to treat or prevent protozoal infections. |
| Applications: | antiseptic drug A substance used locally on humans and other animals to destroy harmful microorganisms or to inhibit their activity (cf. disinfectants, which destroy microorganisms found on non-living objects, and antibiotics, which can be transported through the lymphatic system to destroy bacteria within the body). antibacterial drug A drug used to treat or prevent bacterial infections. antiprotozoal drug Any antimicrobial drug which is used to treat or prevent protozoal infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chlorquinaldol (CHEBI:74500) has role antibacterial drug (CHEBI:36047) |
| chlorquinaldol (CHEBI:74500) has role antiprotozoal drug (CHEBI:35820) |
| chlorquinaldol (CHEBI:74500) has role antiseptic drug (CHEBI:48218) |
| chlorquinaldol (CHEBI:74500) is a monohydroxyquinoline (CHEBI:38775) |
| chlorquinaldol (CHEBI:74500) is a organochlorine compound (CHEBI:36683) |
| IUPAC Name |
|---|
| 5,7-dichloro-2-methylquinolin-8-ol |
| INNs | Source |
|---|---|
| chlorquinaldol | WHO MedNet |
| chlorquinaldol | ChemIDplus |
| chlorquinaldolum | ChemIDplus |
| clorquinaldol | ChemIDplus |
| Synonyms | Source |
|---|---|
| 2-methyl-5,7-dichloro-8-hydroxyquinoline | ChEBI |
| 5,7-dichloro-2-methyl-8-hydroxyquinoline | ChemIDplus |
| 5,7-dichloro-2-methyl-8-quinolinol | ChemIDplus |
| 5,7-dichloro-8-hydroxy-2-methylquinoline | ChEBI |
| 5,7-dichloro-8-hydroxyquinaldine | ChemIDplus |
| 5,7-dichloro-8-quinaldinol | ChemIDplus |
| Citations |
|---|