EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H7Cl2NO |
| Net Charge | 0 |
| Average Mass | 228.078 |
| Monoisotopic Mass | 226.99047 |
| SMILES | Cc1ccc2c(Cl)cc(Cl)c(O)c2n1 |
| InChI | InChI=1S/C10H7Cl2NO/c1-5-2-3-6-7(11)4-8(12)10(14)9(6)13-5/h2-4,14H,1H3 |
| InChIKey | GPTXWRGISTZRIO-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antibacterial drug A drug used to treat or prevent bacterial infections. antiprotozoal drug Any antimicrobial drug which is used to treat or prevent protozoal infections. |
| Applications: | antiseptic drug A substance used locally on humans and other animals to destroy harmful microorganisms or to inhibit their activity (cf. disinfectants, which destroy microorganisms found on non-living objects, and antibiotics, which can be transported through the lymphatic system to destroy bacteria within the body). antibacterial drug A drug used to treat or prevent bacterial infections. antiprotozoal drug Any antimicrobial drug which is used to treat or prevent protozoal infections. antiamoebic agent An antiparasitic agent which is effective against amoeba, a genus of single-celled amoeboids in the family Amoebidae. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chlorquinaldol (CHEBI:74500) has role antiamoebic agent (CHEBI:171664) |
| chlorquinaldol (CHEBI:74500) has role antibacterial drug (CHEBI:36047) |
| chlorquinaldol (CHEBI:74500) has role antiprotozoal drug (CHEBI:35820) |
| chlorquinaldol (CHEBI:74500) has role antiseptic drug (CHEBI:48218) |
| chlorquinaldol (CHEBI:74500) is a monohydroxyquinoline (CHEBI:38775) |
| chlorquinaldol (CHEBI:74500) is a organochlorine compound (CHEBI:36683) |
| IUPAC Name |
|---|
| 5,7-dichloro-2-methylquinolin-8-ol |
| INNs | Source |
|---|---|
| chlorquinaldol | WHO MedNet |
| chlorquinaldol | ChemIDplus |
| chlorquinaldolum | ChemIDplus |
| clorquinaldol | ChemIDplus |
| Synonyms | Source |
|---|---|
| 2-methyl-5,7-dichloro-8-hydroxyquinoline | ChEBI |
| 5,7-dichloro-2-methyl-8-hydroxyquinoline | ChemIDplus |
| 5,7-dichloro-2-methyl-8-quinolinol | ChemIDplus |
| 5,7-dichloro-8-hydroxy-2-methylquinoline | ChEBI |
| 5,7-dichloro-8-hydroxyquinaldine | ChemIDplus |
| 5,7-dichloro-8-quinaldinol | ChemIDplus |
| Brand Name | Source |
|---|---|
| Steroxin | ChEMBL |
| Citations |
|---|