EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H6O3 |
| Net Charge | 0 |
| Average Mass | 114.100 |
| Monoisotopic Mass | 114.03169 |
| SMILES | CC1=C(O)C(=O)CO1 |
| InChI | InChI=1S/C5H6O3/c1-3-5(7)4(6)2-8-3/h7H,2H2,1H3 |
| InChIKey | DLVYTANECMRFGX-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-hydroxy-5-methyl-3-furanone (CHEBI:74456) has functional parent 5-methyl-2,3-dihydrofuran (CHEBI:51677) |
| 4-hydroxy-5-methyl-3-furanone (CHEBI:74456) has role metabolite (CHEBI:25212) |
| 4-hydroxy-5-methyl-3-furanone (CHEBI:74456) is a cyclic ketone (CHEBI:3992) |
| 4-hydroxy-5-methyl-3-furanone (CHEBI:74456) is a enol (CHEBI:33823) |
| 4-hydroxy-5-methyl-3-furanone (CHEBI:74456) is a furans (CHEBI:24129) |
| IUPAC Name |
|---|
| 4-hydroxy-5-methylfuran-3(2H)-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1616957 | Reaxys |
| CAS:19322-27-1 | ChemIDplus |