EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H27NO3 |
| Net Charge | 0 |
| Average Mass | 257.374 |
| Monoisotopic Mass | 257.19909 |
| SMILES | CCCCCCCCCCCC(=O)NCC(=O)O |
| InChI | InChI=1S/C14H27NO3/c1-2-3-4-5-6-7-8-9-10-11-13(16)15-12-14(17)18/h2-12H2,1H3,(H,15,16)(H,17,18) |
| InChIKey | JWGGSJFIGIGFSQ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-dodecanoylglycine (CHEBI:74441) has functional parent dodecanoic acid (CHEBI:30805) |
| N-dodecanoylglycine (CHEBI:74441) has role metabolite (CHEBI:25212) |
| N-dodecanoylglycine (CHEBI:74441) is a N-acylglycine (CHEBI:16180) |
| N-dodecanoylglycine (CHEBI:74441) is a fatty amide (CHEBI:29348) |
| N-dodecanoylglycine (CHEBI:74441) is conjugate acid of N-dodecanoylglycinate (CHEBI:142678) |
| Incoming Relation(s) |
| N-dodecanoylglycinate (CHEBI:142678) is conjugate base of N-dodecanoylglycine (CHEBI:74441) |
| IUPAC Names |
|---|
| (dodecanoylamino)acetic acid |
| N-dodecanoylglycine |
| Synonyms | Source |
|---|---|
| 2-dodecanamidoacetic acid | HMDB |
| Acylglycine c:12 | HMDB |
| dodecanamidoacetic acid | HMDB |
| N-lauroylglycine | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0013272 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1790401 | Reaxys |
| Citations |
|---|