EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H17NO3 |
| Net Charge | 0 |
| Average Mass | 187.239 |
| Monoisotopic Mass | 187.12084 |
| SMILES | CCCCCCC(=O)NCC(=O)O |
| InChI | InChI=1S/C9H17NO3/c1-2-3-4-5-6-8(11)10-7-9(12)13/h2-7H2,1H3,(H,10,11)(H,12,13) |
| InChIKey | RNFCYFVPNIXAHP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-heptanoylglycine (CHEBI:74433) has functional parent heptanoic acid (CHEBI:45571) |
| N-heptanoylglycine (CHEBI:74433) has role metabolite (CHEBI:25212) |
| N-heptanoylglycine (CHEBI:74433) is a N-acylglycine (CHEBI:16180) |
| N-heptanoylglycine (CHEBI:74433) is a fatty amide (CHEBI:29348) |
| IUPAC Name |
|---|
| N-heptanoylglycine |
| Synonyms | Source |
|---|---|
| 2-(Heptanoylamino)acetic acid | HMDB |
| N-(1-Oxoheptyl)glycine | HMDB |
| N-(Carboxymethyl)heptanamide | HMDB |
| (Heptanoylamino)acetic acid | HMDB |
| Manual Xrefs | Databases |
|---|---|
| HMDB0013010 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2360791 | Reaxys |