EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H19N5O14P3 |
| Net Charge | -2 |
| Average Mass | 562.238 |
| Monoisotopic Mass | 562.01523 |
| SMILES | *OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])OC[C@H]1O[C@@H](n2c[n+](C)c3c(=O)nc(N(C)C)nc32)[C@H](O)[C@@H]1O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N2,N2,N7-trimethylguanosine 5'-triphosphate(2−) group (CHEBI:74432) is a organic anionic group (CHEBI:64775) |
| N2,N2,N7-trimethylguanosine 5'-triphosphate(2−) group (CHEBI:74432) is conjugate base of N2,N2,N7-trimethylguanosine 5'-triphosphate group (CHEBI:74658) |
| Incoming Relation(s) |
| N2,N2,N7-trimethylguanosine 5'-triphosphate group (CHEBI:74658) is conjugate acid of N2,N2,N7-trimethylguanosine 5'-triphosphate(2−) group (CHEBI:74432) |
| UniProt Name | Source |
|---|---|
| 5'-(N2,N2,N7-trimethyl 5'-triphosphoguanosine) group | UniProt |
| Citations |
|---|