EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H23NO3 |
| Net Charge | 0 |
| Average Mass | 229.320 |
| Monoisotopic Mass | 229.16779 |
| SMILES | CCCCCCCCCC(=O)NCC(=O)O |
| InChI | InChI=1S/C12H23NO3/c1-2-3-4-5-6-7-8-9-11(14)13-10-12(15)16/h2-10H2,1H3,(H,13,14)(H,15,16) |
| InChIKey | WRRYZYASRAUROW-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-decanoylglycine (CHEBI:74430) has functional parent decanoic acid (CHEBI:30813) |
| N-decanoylglycine (CHEBI:74430) has role metabolite (CHEBI:25212) |
| N-decanoylglycine (CHEBI:74430) is a N-acylglycine (CHEBI:16180) |
| N-decanoylglycine (CHEBI:74430) is a fatty amide (CHEBI:29348) |
| N-decanoylglycine (CHEBI:74430) is a secondary carboxamide (CHEBI:140325) |
| N-decanoylglycine (CHEBI:74430) is conjugate acid of N-decanoylglycinate (CHEBI:142680) |
| Incoming Relation(s) |
| N-decanoylglycinate (CHEBI:142680) is conjugate base of N-decanoylglycine (CHEBI:74430) |
| IUPAC Name |
|---|
| N-decanoylglycine |
| Synonyms | Source |
|---|---|
| Acylglycine c:10 | HMDB |
| caprylglycine | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0013267 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1872050 | Reaxys |
| Citations |
|---|